C26H34O6 — CID 10972261
ditert-butyl 2-[(1R,2S)-1-hydroxy-2-phenyl-2-phenylmethoxyethyl]propanedioate (PubChem CID 10972261) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is ditert-butyl 2-[(1R,2S)-1-hydroxy-2-phenyl-2-phenylmethoxyethyl]propanedioate.
| Compound Name | ditert-butyl 2-[(1R,2S)-1-hydroxy-2-phenyl-2-phenylmethoxyethyl]propanedioate |
|---|---|
| PubChem CID | 10972261 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | ditert-butyl 2-[(1R,2S)-1-hydroxy-2-phenyl-2-phenylmethoxyethyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)[C@@H](O)[C@@H](OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34O6/c1-25(2,3)31-23(28)20(24(29)32-26(4,5)6)21(27)22(19-15-11-8-12-16-19)30-17-18-13-9-7-10-14-18/h7-16,20-22,27H,17H2,1-6H3/t21-,22+/m1/s1 |
| InChIKey | WHMQRMBSHDBFBK-YADHBBJMSA-N |
| XLogP | 4.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|