C26H31NO2 — CID 102123059
(2S)-1-[(1R,2R)-1,2-diphenyl-2-phenylmethoxyethoxy]-2-methylbutan-2-amine (PubChem CID 102123059) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (2S)-1-[(1R,2R)-1,2-diphenyl-2-phenylmethoxyethoxy]-2-methylbutan-2-amine.
| Compound Name | (2S)-1-[(1R,2R)-1,2-diphenyl-2-phenylmethoxyethoxy]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 102123059 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (2S)-1-[(1R,2R)-1,2-diphenyl-2-phenylmethoxyethoxy]-2-methylbutan-2-amine |
| SMILES | CC[C@](C)(N)CO[C@H](c1ccccc1)[C@H](OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO2/c1-3-26(2,27)20-29-25(23-17-11-6-12-18-23)24(22-15-9-5-10-16-22)28-19-21-13-7-4-8-14-21/h4-18,24-25H,3,19-20,27H2,1-2H3/t24-,25-,26+/m1/s1 |
| InChIKey | LSOJYPWVXNYEIN-CYXNTTPDSA-N |
| XLogP | 5.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |