C15H26O — CID 143788890
[(2S)-3,3-dimethylbutan-2-yl]oxymethylbenzene;ethane (PubChem CID 143788890) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is [(2S)-3,3-dimethylbutan-2-yl]oxymethylbenzene;ethane.
| Compound Name | [(2S)-3,3-dimethylbutan-2-yl]oxymethylbenzene;ethane |
|---|---|
| PubChem CID | 143788890 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | [(2S)-3,3-dimethylbutan-2-yl]oxymethylbenzene;ethane |
| SMILES | CC.C[C@H](OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C13H20O.C2H6/c1-11(13(2,3)4)14-10-12-8-6-5-7-9-12;1-2/h5-9,11H,10H2,1-4H3;1-2H3/t11-;/m0./s1 |
| InChIKey | CKYOPYMWMOHZBP-MERQFXBCSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |