C18H20Br2O2 — CID 101207998
[(2R,3R)-1,4-dibromo-3-phenylmethoxybutan-2-yl]oxymethylbenzene (PubChem CID 101207998) has the molecular formula C18H20Br2O2 and a molecular weight of 428.16 g/mol. Its IUPAC name is [(2R,3R)-1,4-dibromo-3-phenylmethoxybutan-2-yl]oxymethylbenzene.
| Compound Name | [(2R,3R)-1,4-dibromo-3-phenylmethoxybutan-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 101207998 |
| Molecular Formula | C18H20Br2O2 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | [(2R,3R)-1,4-dibromo-3-phenylmethoxybutan-2-yl]oxymethylbenzene |
| SMILES | BrC[C@H](OCc1ccccc1)[C@H](CBr)OCc1ccccc1 |
| InChI | InChI=1S/C18H20Br2O2/c19-11-17(21-13-15-7-3-1-4-8-15)18(12-20)22-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | DQOBFSQUSLTOAG-ROUUACIJSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|