C18H18Br4O2 — CID 132518009
1-bromo-4-[[(2R,3R)-1,4-dibromo-3-[(4-bromophenyl)methoxy]butan-2-yl]oxymethyl]benzene (PubChem CID 132518009) has the molecular formula C18H18Br4O2 and a molecular weight of 585.96 g/mol. Its IUPAC name is 1-bromo-4-[[(2R,3R)-1,4-dibromo-3-[(4-bromophenyl)methoxy]butan-2-yl]oxymethyl]benzene.
| Compound Name | 1-bromo-4-[[(2R,3R)-1,4-dibromo-3-[(4-bromophenyl)methoxy]butan-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 132518009 |
| Molecular Formula | C18H18Br4O2 |
| Molecular Weight | 585.96 g/mol |
| Exact Mass | 581.80 |
| IUPAC Name | 1-bromo-4-[[(2R,3R)-1,4-dibromo-3-[(4-bromophenyl)methoxy]butan-2-yl]oxymethyl]benzene |
| SMILES | BrC[C@H](OCc1ccc(Br)cc1)[C@H](CBr)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18Br4O2/c19-9-17(23-11-13-1-5-15(21)6-2-13)18(10-20)24-12-14-3-7-16(22)8-4-14/h1-8,17-18H,9-12H2/t17-,18-/m0/s1 |
| InChIKey | VIGYVDBSIFHFOM-ROUUACIJSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.96 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|