C13H20BrNO — CID 82828053
2-[(4-bromophenyl)methoxy]-3,3-dimethylbutan-1-amine (PubChem CID 82828053) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methoxy]-3,3-dimethylbutan-1-amine.
| Compound Name | 2-[(4-bromophenyl)methoxy]-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 82828053 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(4-bromophenyl)methoxy]-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)C(CN)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H20BrNO/c1-13(2,3)12(8-15)16-9-10-4-6-11(14)7-5-10/h4-7,12H,8-9,15H2,1-3H3 |
| InChIKey | NBQQYJVIBQOOAA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |