C12H17BrO — CID 60798446
1-(4-bromophenyl)-3,3-dimethylbutan-2-ol (PubChem CID 60798446) has the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(4-bromophenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 60798446 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(4-bromophenyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrO/c1-12(2,3)11(14)8-9-4-6-10(13)7-5-9/h4-7,11,14H,8H2,1-3H3 |
| InChIKey | AUODCSZSIURJCP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |