C12H18O — CID 12689722
(2S)-3,3-dimethyl-1-phenylbutan-2-ol (PubChem CID 12689722) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-1-phenylbutan-2-ol.
| Compound Name | (2S)-3,3-dimethyl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 12689722 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2S)-3,3-dimethyl-1-phenylbutan-2-ol |
| SMILES | CC(C)(C)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C12H18O/c1-12(2,3)11(13)9-10-7-5-4-6-8-10/h4-8,11,13H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | PDQJOXWPESMTAG-NSHDSACASA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |