C13H20O3 — CID 141215630
3-methyl-1-phenylhexane-2,3,5-triol (PubChem CID 141215630) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-methyl-1-phenylhexane-2,3,5-triol.
| Compound Name | 3-methyl-1-phenylhexane-2,3,5-triol |
|---|---|
| PubChem CID | 141215630 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-methyl-1-phenylhexane-2,3,5-triol |
| SMILES | CC(O)CC(C)(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C13H20O3/c1-10(14)9-13(2,16)12(15)8-11-6-4-3-5-7-11/h3-7,10,12,14-16H,8-9H2,1-2H3 |
| InChIKey | VELGVBZAIQXHKN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |