C20H26O — CID 139443987
2,2,4-trimethyl-1,5-diphenylpentan-3-ol (PubChem CID 139443987) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 2,2,4-trimethyl-1,5-diphenylpentan-3-ol.
| Compound Name | 2,2,4-trimethyl-1,5-diphenylpentan-3-ol |
|---|---|
| PubChem CID | 139443987 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2,2,4-trimethyl-1,5-diphenylpentan-3-ol |
| SMILES | CC(Cc1ccccc1)C(O)C(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H26O/c1-16(14-17-10-6-4-7-11-17)19(21)20(2,3)15-18-12-8-5-9-13-18/h4-13,16,19,21H,14-15H2,1-3H3 |
| InChIKey | JCXLZGCOQFAUES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |