C15H24O3 — CID 101485670
1,1-diethoxy-3-methyl-4-phenylbutan-2-ol (PubChem CID 101485670) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1,1-diethoxy-3-methyl-4-phenylbutan-2-ol.
| Compound Name | 1,1-diethoxy-3-methyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 101485670 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1,1-diethoxy-3-methyl-4-phenylbutan-2-ol |
| SMILES | CCOC(OCC)C(O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H24O3/c1-4-17-15(18-5-2)14(16)12(3)11-13-9-7-6-8-10-13/h6-10,12,14-16H,4-5,11H2,1-3H3 |
| InChIKey | SKTMKLVZSVZFNU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|