About sodium;hydride;1-phenylpropan-2-ol
sodium;hydride;1-phenylpropan-2-ol (PubChem CID 175039142) has the molecular formula C9H13NaO
and a molecular weight of 160.19 g/mol. Its IUPAC name is sodium;hydride;1-phenylpropan-2-ol.
Molecular Properties
| Compound Name | sodium;hydride;1-phenylpropan-2-ol |
| PubChem CID | 175039142 |
| Molecular Formula | C9H13NaO |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | sodium;hydride;1-phenylpropan-2-ol |
| SMILES | CC(O)Cc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C9H12O.Na.H/c1-8(10)7-9-5-3-2-4-6-9;;/h2-6,8,10H,7H2,1H3;;/q;+1;-1 |
| InChIKey | YJBSRTWNOWNVPP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;hydride;1-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-phenylpropan-2-ol?
The IUPAC name of sodium;hydride;1-phenylpropan-2-ol (CID 175039142) is sodium;hydride;1-phenylpropan-2-ol.
What is the SMILES notation for sodium;hydride;1-phenylpropan-2-ol?
The canonical SMILES for sodium;hydride;1-phenylpropan-2-ol is CC(O)Cc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-phenylpropan-2-ol?
The InChIKey is YJBSRTWNOWNVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.Na.H/c1-8(10)7-9-5-3-2-4-6-9;;/h2-6,8,10H,7H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;1-phenylpropan-2-ol?
sodium;hydride;1-phenylpropan-2-ol has a molecular weight of 160.19 g/mol, XLogP of -1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-phenylpropan-2-ol is sourced from PubChem (CID 175039142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).