About ethane;2-methylpropylbenzene
ethane;2-methylpropylbenzene (PubChem CID 162200929) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is ethane;2-methylpropylbenzene.
Molecular Properties
| Compound Name | ethane;2-methylpropylbenzene |
| PubChem CID | 162200929 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | ethane;2-methylpropylbenzene |
| SMILES | CC.CC.CC.CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H14.3C2H6/c1-9(2)8-10-6-4-3-5-7-10;3*1-2/h3-7,9H,8H2,1-2H3;3*1-2H3 |
| InChIKey | ZROLYRMYIFHGNW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropylbenzene?
The IUPAC name of ethane;2-methylpropylbenzene (CID 162200929) is ethane;2-methylpropylbenzene.
What is the SMILES notation for ethane;2-methylpropylbenzene?
The canonical SMILES for ethane;2-methylpropylbenzene is CC.CC.CC.CC(C)Cc1ccccc1.
What is the InChIKey of ethane;2-methylpropylbenzene?
The InChIKey is ZROLYRMYIFHGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.3C2H6/c1-9(2)8-10-6-4-3-5-7-10;3*1-2/h3-7,9H,8H2,1-2H3;3*1-2H3.
What are the key properties of ethane;2-methylpropylbenzene?
ethane;2-methylpropylbenzene has a molecular weight of 224.43 g/mol, XLogP of 5.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropylbenzene is sourced from PubChem (CID 162200929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).