About methane;2-methylpropylbenzene;pentane
methane;2-methylpropylbenzene;pentane (PubChem CID 162015938) has the molecular formula C17H34
and a molecular weight of 238.46 g/mol. Its IUPAC name is methane;2-methylpropylbenzene;pentane.
Molecular Properties
| Compound Name | methane;2-methylpropylbenzene;pentane |
| PubChem CID | 162015938 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | methane;2-methylpropylbenzene;pentane |
| SMILES | C.C.CC(C)Cc1ccccc1.CCCCC |
| InChI | InChI=1S/C10H14.C5H12.2CH4/c1-9(2)8-10-6-4-3-5-7-10;1-3-5-4-2;;/h3-7,9H,8H2,1-2H3;3-5H2,1-2H3;2*1H4 |
| InChIKey | YUCIOYZNEATBDC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;2-methylpropylbenzene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpropylbenzene;pentane?
The IUPAC name of methane;2-methylpropylbenzene;pentane (CID 162015938) is methane;2-methylpropylbenzene;pentane.
What is the SMILES notation for methane;2-methylpropylbenzene;pentane?
The canonical SMILES for methane;2-methylpropylbenzene;pentane is C.C.CC(C)Cc1ccccc1.CCCCC.
What is the InChIKey of methane;2-methylpropylbenzene;pentane?
The InChIKey is YUCIOYZNEATBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C5H12.2CH4/c1-9(2)8-10-6-4-3-5-7-10;1-3-5-4-2;;/h3-7,9H,8H2,1-2H3;3-5H2,1-2H3;2*1H4.
What are the key properties of methane;2-methylpropylbenzene;pentane?
methane;2-methylpropylbenzene;pentane has a molecular weight of 238.46 g/mol, XLogP of 6.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpropylbenzene;pentane is sourced from PubChem (CID 162015938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).