About 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene
1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene (PubChem CID 145233135) has the molecular formula C20H27F
and a molecular weight of 286.43 g/mol. Its IUPAC name is 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene |
| PubChem CID | 145233135 |
| Molecular Formula | C20H27F |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene |
| SMILES | CC(C)Cc1ccc(F)cc1.CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H13F.C10H14/c1-8(2)7-9-3-5-10(11)6-4-9;1-9(2)8-10-6-4-3-5-7-10/h3-6,8H,7H2,1-2H3;3-7,9H,8H2,1-2H3 |
| InChIKey | TYRSRSJJASTTMV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene?
The IUPAC name of 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene (CID 145233135) is 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene.
What is the SMILES notation for 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene?
The canonical SMILES for 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene is CC(C)Cc1ccc(F)cc1.CC(C)Cc1ccccc1.
What is the InChIKey of 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene?
The InChIKey is TYRSRSJJASTTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F.C10H14/c1-8(2)7-9-3-5-10(11)6-4-9;1-9(2)8-10-6-4-3-5-7-10/h3-6,8H,7H2,1-2H3;3-7,9H,8H2,1-2H3.
What are the key properties of 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene?
1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene has a molecular weight of 286.43 g/mol, XLogP of 5.91, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(2-methylpropyl)benzene;2-methylpropylbenzene is sourced from PubChem (CID 145233135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).