C22H30O — CID 23168110
2-methylpropylbenzene;1-[4-(2-methylpropyl)phenyl]ethanone (PubChem CID 23168110) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-methylpropylbenzene;1-[4-(2-methylpropyl)phenyl]ethanone.
| Compound Name | 2-methylpropylbenzene;1-[4-(2-methylpropyl)phenyl]ethanone |
|---|---|
| PubChem CID | 23168110 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2-methylpropylbenzene;1-[4-(2-methylpropyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(CC(C)C)cc1.CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C12H16O.C10H14/c1-9(2)8-11-4-6-12(7-5-11)10(3)13;1-9(2)8-10-6-4-3-5-7-10/h4-7,9H,8H2,1-3H3;3-7,9H,8H2,1-2H3 |
| InChIKey | CDCQAQVVTLQBER-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |