C14H22O2 — CID 10922116
(2S,3R)-3-benzyl-4,4-dimethylpentane-2,3-diol (PubChem CID 10922116) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2S,3R)-3-benzyl-4,4-dimethylpentane-2,3-diol.
| Compound Name | (2S,3R)-3-benzyl-4,4-dimethylpentane-2,3-diol |
|---|---|
| PubChem CID | 10922116 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2S,3R)-3-benzyl-4,4-dimethylpentane-2,3-diol |
| SMILES | C[C@H](O)[C@@](O)(Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H22O2/c1-11(15)14(16,13(2,3)4)10-12-8-6-5-7-9-12/h5-9,11,15-16H,10H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | VDUJMPHSISJLCE-FZMZJTMJSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |