C17H22O6 — CID 141484167
(5R)-5-[(2R,3R)-2,3-dihydroxy-1-phenylbutan-2-yl]-5-hydroxyheptane-2,3,6-trione (PubChem CID 141484167) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is (5R)-5-[(2R,3R)-2,3-dihydroxy-1-phenylbutan-2-yl]-5-hydroxyheptane-2,3,6-trione.
| Compound Name | (5R)-5-[(2R,3R)-2,3-dihydroxy-1-phenylbutan-2-yl]-5-hydroxyheptane-2,3,6-trione |
|---|---|
| PubChem CID | 141484167 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (5R)-5-[(2R,3R)-2,3-dihydroxy-1-phenylbutan-2-yl]-5-hydroxyheptane-2,3,6-trione |
| SMILES | CC(=O)C(=O)C[C@](O)(C(C)=O)[C@@](O)(Cc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C17H22O6/c1-11(18)15(21)10-17(23,13(3)20)16(22,12(2)19)9-14-7-5-4-6-8-14/h4-8,12,19,22-23H,9-10H2,1-3H3/t12-,16-,17+/m1/s1 |
| InChIKey | IRWGQNNOQWUNLG-JLZZUVOBSA-N |
| XLogP | 0.21 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|