C11H13Cl3O3 — CID 174431181
acetic acid;1,1,1-trichloro-3-phenylpropan-2-ol (PubChem CID 174431181) has the molecular formula C11H13Cl3O3 and a molecular weight of 299.58 g/mol. Its IUPAC name is acetic acid;1,1,1-trichloro-3-phenylpropan-2-ol.
| Compound Name | acetic acid;1,1,1-trichloro-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 174431181 |
| Molecular Formula | C11H13Cl3O3 |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | acetic acid;1,1,1-trichloro-3-phenylpropan-2-ol |
| SMILES | CC(=O)O.OC(Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H9Cl3O.C2H4O2/c10-9(11,12)8(13)6-7-4-2-1-3-5-7;1-2(3)4/h1-5,8,13H,6H2;1H3,(H,3,4) |
| InChIKey | UGYWGCQKFRKJQH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|