C13H20O — CID 11805570
(2S)-2-benzyl-3,3-dimethylbutan-1-ol (PubChem CID 11805570) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2S)-2-benzyl-3,3-dimethylbutan-1-ol.
| Compound Name | (2S)-2-benzyl-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 11805570 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2S)-2-benzyl-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C13H20O/c1-13(2,3)12(10-14)9-11-7-5-4-6-8-11/h4-8,12,14H,9-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | IUQMCUXWPFCKKN-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |