C15H26O5S — CID 71342429
3,3-dimethyl-2-(phenylmethoxymethyl)butan-1-ol;methanesulfonic acid (PubChem CID 71342429) has the molecular formula C15H26O5S and a molecular weight of 318.43 g/mol. Its IUPAC name is 3,3-dimethyl-2-(phenylmethoxymethyl)butan-1-ol;methanesulfonic acid.
| Compound Name | 3,3-dimethyl-2-(phenylmethoxymethyl)butan-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 71342429 |
| Molecular Formula | C15H26O5S |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3,3-dimethyl-2-(phenylmethoxymethyl)butan-1-ol;methanesulfonic acid |
| SMILES | CC(C)(C)C(CO)COCc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C14H22O2.CH4O3S/c1-14(2,3)13(9-15)11-16-10-12-7-5-4-6-8-12;1-5(2,3)4/h4-8,13,15H,9-11H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | QCDXIVXKOZAXEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|