C11H13F3O3S — CID 129057985
(2,3,3-trifluoro-3-methylsulfonylpropoxy)methylbenzene (PubChem CID 129057985) has the molecular formula C11H13F3O3S and a molecular weight of 282.28 g/mol. Its IUPAC name is (2,3,3-trifluoro-3-methylsulfonylpropoxy)methylbenzene.
| Compound Name | (2,3,3-trifluoro-3-methylsulfonylpropoxy)methylbenzene |
|---|---|
| PubChem CID | 129057985 |
| Molecular Formula | C11H13F3O3S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (2,3,3-trifluoro-3-methylsulfonylpropoxy)methylbenzene |
| SMILES | CS(=O)(=O)C(F)(F)C(F)COCc1ccccc1 |
| InChI | InChI=1S/C11H13F3O3S/c1-18(15,16)11(13,14)10(12)8-17-7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | VYOVWCQCWOOGPK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |