C13H18O5S — CID 87381378
[(2S)-2-[(2S)-oxiran-2-yl]-3-phenylmethoxypropyl] methanesulfonate (PubChem CID 87381378) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is [(2S)-2-[(2S)-oxiran-2-yl]-3-phenylmethoxypropyl] methanesulfonate.
| Compound Name | [(2S)-2-[(2S)-oxiran-2-yl]-3-phenylmethoxypropyl] methanesulfonate |
|---|---|
| PubChem CID | 87381378 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(2S)-2-[(2S)-oxiran-2-yl]-3-phenylmethoxypropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](COCc1ccccc1)[C@H]1CO1 |
| InChI | InChI=1S/C13H18O5S/c1-19(14,15)18-9-12(13-10-17-13)8-16-7-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | OWEPHDKZHSZNET-QWHCGFSZSA-N |
| XLogP | 1.19 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|