C14H22O7S2 — CID 10690263
[(3R)-3-(methylsulfonyloxymethyl)-4-phenylmethoxybutyl] methanesulfonate (PubChem CID 10690263) has the molecular formula C14H22O7S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(3R)-3-(methylsulfonyloxymethyl)-4-phenylmethoxybutyl] methanesulfonate.
| Compound Name | [(3R)-3-(methylsulfonyloxymethyl)-4-phenylmethoxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 10690263 |
| Molecular Formula | C14H22O7S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [(3R)-3-(methylsulfonyloxymethyl)-4-phenylmethoxybutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@H](COCc1ccccc1)COS(C)(=O)=O |
| InChI | InChI=1S/C14H22O7S2/c1-22(15,16)20-9-8-14(12-21-23(2,17)18)11-19-10-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | VPVINYNJFXKXGW-CQSZACIVSA-N |
| XLogP | 1.16 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|