C17H28O6S — CID 151732579
2-[2-(5-phenylmethoxypentoxy)ethoxy]ethyl methanesulfonate (PubChem CID 151732579) has the molecular formula C17H28O6S and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-[2-(5-phenylmethoxypentoxy)ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-(5-phenylmethoxypentoxy)ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 151732579 |
| Molecular Formula | C17H28O6S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[2-(5-phenylmethoxypentoxy)ethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCOCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C17H28O6S/c1-24(18,19)23-15-14-21-13-12-20-10-6-3-7-11-22-16-17-8-4-2-5-9-17/h2,4-5,8-9H,3,6-7,10-16H2,1H3 |
| InChIKey | RKVZWTNODSEVRM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|