C15H24O6S — CID 118048156
2-[2-[2-[(4-methylphenyl)methoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 118048156) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[2-[2-[(4-methylphenyl)methoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[(4-methylphenyl)methoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118048156 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[2-[2-[(4-methylphenyl)methoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | Cc1ccc(COCCOCCOCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24O6S/c1-14-3-5-15(6-4-14)13-20-10-9-18-7-8-19-11-12-21-22(2,16)17/h3-6H,7-13H2,1-2H3 |
| InChIKey | GGPMUWBKSQHTOX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|