C14H20O8S — CID 101148234
[(1S)-2-phenylmethoxy-1-[(2S,3R,4S)-3,4,5-trihydroxyoxolan-2-yl]ethyl] methanesulfonate (PubChem CID 101148234) has the molecular formula C14H20O8S and a molecular weight of 348.37 g/mol. Its IUPAC name is [(1S)-2-phenylmethoxy-1-[(2S,3R,4S)-3,4,5-trihydroxyoxolan-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-2-phenylmethoxy-1-[(2S,3R,4S)-3,4,5-trihydroxyoxolan-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 101148234 |
| Molecular Formula | C14H20O8S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [(1S)-2-phenylmethoxy-1-[(2S,3R,4S)-3,4,5-trihydroxyoxolan-2-yl]ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](COCc1ccccc1)[C@H]1OC(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20O8S/c1-23(18,19)22-10(13-11(15)12(16)14(17)21-13)8-20-7-9-5-3-2-4-6-9/h2-6,10-17H,7-8H2,1H3/t10-,11+,12-,13+,14?/m0/s1 |
| InChIKey | ZKWRRGSFSNCXRZ-IZXDZPFWSA-N |
| XLogP | -1.01 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|