C34H36O6 — CID 102374527
(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2,4-bis(phenylmethoxy)oxolan-3-ol (PubChem CID 102374527) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2,4-bis(phenylmethoxy)oxolan-3-ol.
| Compound Name | (2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2,4-bis(phenylmethoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 102374527 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2,4-bis(phenylmethoxy)oxolan-3-ol |
| SMILES | O[C@H]1[C@@H](OCc2ccccc2)O[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H36O6/c35-31-33(38-23-28-17-9-3-10-18-28)32(40-34(31)39-24-29-19-11-4-12-20-29)30(37-22-27-15-7-2-8-16-27)25-36-21-26-13-5-1-6-14-26/h1-20,30-35H,21-25H2/t30-,31-,32-,33-,34+/m1/s1 |
| InChIKey | MAFIRTOCUZVUBT-NEPHXMAZSA-N |
| XLogP | 5.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |