C36H42O10 — CID 102088502
diethyl (E)-3-[(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]oxypent-2-enedioate (PubChem CID 102088502) has the molecular formula C36H42O10 and a molecular weight of 634.72 g/mol. Its IUPAC name is diethyl (E)-3-[(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]oxypent-2-enedioate.
| Compound Name | diethyl (E)-3-[(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]oxypent-2-enedioate |
|---|---|
| PubChem CID | 102088502 |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | diethyl (E)-3-[(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]oxypent-2-enedioate |
| SMILES | CCOC(=O)/C=C(\CC(=O)OCC)O[C@@H]1O[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C36H42O10/c1-3-41-31(37)20-29(21-32(38)42-4-2)45-36-33(39)35(44-24-28-18-12-7-13-19-28)34(46-36)30(43-23-27-16-10-6-11-17-27)25-40-22-26-14-8-5-9-15-26/h5-20,30,33-36,39H,3-4,21-25H2,1-2H3/b29-20+/t30-,33-,34-,35-,36-/m1/s1 |
| InChIKey | AUYYDPBBXLPZNF-IKRSQVFSSA-N |
| XLogP | 4.88 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|