C47H44N2O6Se — CID 177391011
[(2S,3R,4S,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxy-2-phenylselanyloxolan-3-yl] (2E)-2-(diphenylhydrazinylidene)acetate (PubChem CID 177391011) has the molecular formula C47H44N2O6Se and a molecular weight of 811.84 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxy-2-phenylselanyloxolan-3-yl] (2E)-2-(diphenylhydrazinylidene)acetate.
| Compound Name | [(2S,3R,4S,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxy-2-phenylselanyloxolan-3-yl] (2E)-2-(diphenylhydrazinylidene)acetate |
|---|---|
| PubChem CID | 177391011 |
| Molecular Formula | C47H44N2O6Se |
| Molecular Weight | 811.84 g/mol |
| Exact Mass | 812.24 |
| IUPAC Name | [(2S,3R,4S,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxy-2-phenylselanyloxolan-3-yl] (2E)-2-(diphenylhydrazinylidene)acetate |
| SMILES | O=C(/C=N/N(c1ccccc1)c1ccccc1)O[C@@H]1[C@@H](OCc2ccccc2)[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)O[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C47H44N2O6Se/c50-43(31-48-49(39-25-13-4-14-26-39)40-27-15-5-16-28-40)54-46-45(53-34-38-23-11-3-12-24-38)44(55-47(46)56-41-29-17-6-18-30-41)42(52-33-37-21-9-2-10-22-37)35-51-32-36-19-7-1-8-20-36/h1-31,42,44-47H,32-35H2/b48-31+/t42-,44-,45+,46-,47+/m1/s1 |
| InChIKey | RHRWSWZAEXFIDG-XNUYAVBESA-N |
| XLogP | 7.86 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.84 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|