C38H44N2O7 — CID 58595005
1-[2-[(3S,4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methyl-4-phenylmethoxyoxolan-3-yl]oxyethyl]-3-phenylmethoxyurea (PubChem CID 58595005) has the molecular formula C38H44N2O7 and a molecular weight of 640.78 g/mol. Its IUPAC name is 1-[2-[(3S,4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methyl-4-phenylmethoxyoxolan-3-yl]oxyethyl]-3-phenylmethoxyurea.
| Compound Name | 1-[2-[(3S,4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methyl-4-phenylmethoxyoxolan-3-yl]oxyethyl]-3-phenylmethoxyurea |
|---|---|
| PubChem CID | 58595005 |
| Molecular Formula | C38H44N2O7 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 1-[2-[(3S,4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methyl-4-phenylmethoxyoxolan-3-yl]oxyethyl]-3-phenylmethoxyurea |
| SMILES | CC1O[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCCNC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C38H44N2O7/c1-29-35(43-23-22-39-38(41)40-46-27-33-20-12-5-13-21-33)37(45-26-32-18-10-4-11-19-32)36(47-29)34(44-25-31-16-8-3-9-17-31)28-42-24-30-14-6-2-7-15-30/h2-21,29,34-37H,22-28H2,1H3,(H2,39,40,41)/t29?,34-,35+,36+,37-/m1/s1 |
| InChIKey | QBGAIUHIWOGGGF-NOOQOSAHSA-N |
| XLogP | 5.98 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|