C44H48O8 — CID 101344107
(2R,3S,4S,5S,6S)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)oxane (PubChem CID 101344107) has the molecular formula C44H48O8 and a molecular weight of 704.86 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3S,4S,5S,6S)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 101344107 |
| Molecular Formula | C44H48O8 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)oxane |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OC)O[C@H]([C@@H](COCc3ccccc3)OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H48O8/c1-45-38-25-23-37(24-26-38)31-51-43-42(50-30-36-21-13-6-14-22-36)41(49-29-35-19-11-5-12-20-35)40(52-44(43)46-2)39(48-28-34-17-9-4-10-18-34)32-47-27-33-15-7-3-8-16-33/h3-26,39-44H,27-32H2,1-2H3/t39-,40-,41-,42+,43+,44+/m1/s1 |
| InChIKey | ISUDEMBJJKKXJO-CHQVDDTMSA-N |
| XLogP | 7.92 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |