C31H36O7 — CID 11813327
(3aR,5R,6S,6aR)-5-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11813327) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11813327 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COc1ccc(COC[C@@H](OCc2ccccc2)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H36O7/c1-31(2)37-29-28(35-20-23-12-8-5-9-13-23)27(36-30(29)38-31)26(34-19-22-10-6-4-7-11-22)21-33-18-24-14-16-25(32-3)17-15-24/h4-17,26-30H,18-21H2,1-3H3/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | KJNQWBWJPCASCE-CMPUJJQDSA-N |
| XLogP | 5.26 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |