C24H28O7 — CID 11590003
(3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 11590003) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 11590003 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@@H](CC(=O)O)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28O7/c1-24(2)30-22-21(28-14-15-7-5-4-6-8-15)20(29-23(22)31-24)18(13-19(25)26)16-9-11-17(27-3)12-10-16/h4-12,18,20-23H,13-14H2,1-3H3,(H,25,26)/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | YKZJFKSWQKLCOH-DODNOZFWSA-N |
| XLogP | 3.72 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |