C19H24O8 — CID 11057992
methyl (3R)-3-[(3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-formyloxypropanoate (PubChem CID 11057992) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is methyl (3R)-3-[(3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-formyloxypropanoate.
| Compound Name | methyl (3R)-3-[(3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-formyloxypropanoate |
|---|---|
| PubChem CID | 11057992 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | methyl (3R)-3-[(3aS,5R,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-formyloxypropanoate |
| SMILES | COC(=O)C[C@@H](OC=O)[C@H]1O[C@H]2OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H24O8/c1-19(2)26-17-16(23-10-12-7-5-4-6-8-12)15(25-18(17)27-19)13(24-11-20)9-14(21)22-3/h4-8,11,13,15-18H,9-10H2,1-3H3/t13-,15-,16-,17+,18+/m1/s1 |
| InChIKey | VKBSIXUUWHWNQT-XABWRGDLSA-N |
| XLogP | 1.55 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|