C25H35NO8 — CID 11454381
ethyl (Z)-3-[[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethoxy-3-oxopropyl]amino]but-2-enoate (PubChem CID 11454381) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is ethyl (Z)-3-[[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethoxy-3-oxopropyl]amino]but-2-enoate.
| Compound Name | ethyl (Z)-3-[[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethoxy-3-oxopropyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 11454381 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | ethyl (Z)-3-[[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethoxy-3-oxopropyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)NC(CC(=O)OCC)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H35NO8/c1-6-29-19(27)13-16(3)26-18(14-20(28)30-7-2)21-22(31-15-17-11-9-8-10-12-17)23-24(32-21)34-25(4,5)33-23/h8-13,18,21-24,26H,6-7,14-15H2,1-5H3/b16-13-/t18?,21-,22+,23-,24-/m1/s1 |
| InChIKey | XCTCRDJYFWQNEB-VLBBUPKZSA-N |
| XLogP | 2.83 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|