C18H29NO7 — CID 101260128
ethyl 3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(E)-4-oxopent-2-en-2-yl]amino]propanoate (PubChem CID 101260128) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is ethyl 3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(E)-4-oxopent-2-en-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(E)-4-oxopent-2-en-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 101260128 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | ethyl 3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(E)-4-oxopent-2-en-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CC(N/C(C)=C/C(C)=O)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C18H29NO7/c1-7-23-13(21)9-12(19-10(2)8-11(3)20)14-15(22-6)16-17(24-14)26-18(4,5)25-16/h8,12,14-17,19H,7,9H2,1-6H3/b10-8+/t12?,14?,15-,16+,17+/m0/s1 |
| InChIKey | KKQQXZDOIHKUMB-HZZODRQXSA-N |
| XLogP | 1.28 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|