C15H26N2O7 — CID 71489561
methyl (3R)-3-[(3aR,5R,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(2S)-2-aminopropanoyl]amino]propanoate (PubChem CID 71489561) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl (3R)-3-[(3aR,5R,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(2S)-2-aminopropanoyl]amino]propanoate.
| Compound Name | methyl (3R)-3-[(3aR,5R,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(2S)-2-aminopropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 71489561 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | methyl (3R)-3-[(3aR,5R,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(2S)-2-aminopropanoyl]amino]propanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)[C@H](C)N)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OC |
| InChI | InChI=1S/C15H26N2O7/c1-7(16)13(19)17-8(6-9(18)20-4)10-11(21-5)12-14(22-10)24-15(2,3)23-12/h7-8,10-12,14H,6,16H2,1-5H3,(H,17,19)/t7-,8+,10+,11+,12+,14+/m0/s1 |
| InChIKey | ICKPVCRNYUXOGT-UNJYRZTGSA-N |
| XLogP | -0.73 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |