C12H21NO6 — CID 23599628
methyl 3-amino-3-(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propanoate (PubChem CID 23599628) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl 3-amino-3-(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propanoate.
| Compound Name | methyl 3-amino-3-(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 23599628 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | methyl 3-amino-3-(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propanoate |
| SMILES | COC(=O)CC(N)C1OC2OC(C)(C)OC2C1OC |
| InChI | InChI=1S/C12H21NO6/c1-12(2)18-10-9(16-4)8(17-11(10)19-12)6(13)5-7(14)15-3/h6,8-11H,5,13H2,1-4H3 |
| InChIKey | YRIVNLPKEMNSQB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |