C15H24F3NO8 — CID 139251175
methyl (4S)-4-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-aminobutanoate;2,2,2-trifluoroacetic acid (PubChem CID 139251175) has the molecular formula C15H24F3NO8 and a molecular weight of 403.35 g/mol. Its IUPAC name is methyl (4S)-4-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-aminobutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (4S)-4-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-aminobutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139251175 |
| Molecular Formula | C15H24F3NO8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl (4S)-4-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-aminobutanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)CC[C@H](N)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H23NO6.C2HF3O2/c1-13(2)19-11-10(17-4)9(18-12(11)20-13)7(14)5-6-8(15)16-3;3-2(4,5)1(6)7/h7,9-12H,5-6,14H2,1-4H3;(H,6,7)/t7-,9+,10-,11+,12+;/m0./s1 |
| InChIKey | DMFFOLHMNJKZAF-IOQAQIFDSA-N |
| XLogP | 0.79 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |