C20H27NO8 — CID 10811468
methyl (4R)-4-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 10811468) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl (4R)-4-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (4R)-4-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10811468 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | methyl (4R)-4-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)CC[C@@H](NC(=O)OCc1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C20H27NO8/c1-20(2)28-17-15(23)16(27-18(17)29-20)13(9-10-14(22)25-3)21-19(24)26-11-12-7-5-4-6-8-12/h4-8,13,15-18,23H,9-11H2,1-3H3,(H,21,24)/t13-,15+,16-,17-,18-/m1/s1 |
| InChIKey | NXOMBTCAKUHCPE-REEYDVFISA-N |
| XLogP | 1.47 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |