C17H22O7 — CID 71166517
methyl (3aR,6S,7R)-6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate (PubChem CID 71166517) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl (3aR,6S,7R)-6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate.
| Compound Name | methyl (3aR,6S,7R)-6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate |
|---|---|
| PubChem CID | 71166517 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl (3aR,6S,7R)-6-hydroxy-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate |
| SMILES | COC(=O)C1O[C@@H]2OC(C)(C)OC2[C@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C17H22O7/c1-17(2)23-14-12(21-9-10-7-5-4-6-8-10)11(18)13(15(19)20-3)22-16(14)24-17/h4-8,11-14,16,18H,9H2,1-3H3/t11-,12+,13?,14?,16+/m0/s1 |
| InChIKey | QGQVAMVWIQWPBO-XYMADENCSA-N |
| XLogP | 0.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |