C11H14BrNO5 — CID 102258928
(2R)-2-[(3aS,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromoacetyl cyanide (PubChem CID 102258928) has the molecular formula C11H14BrNO5 and a molecular weight of 320.14 g/mol. Its IUPAC name is (2R)-2-[(3aS,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromoacetyl cyanide.
| Compound Name | (2R)-2-[(3aS,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromoacetyl cyanide |
|---|---|
| PubChem CID | 102258928 |
| Molecular Formula | C11H14BrNO5 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (2R)-2-[(3aS,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromoacetyl cyanide |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@@H]2O[C@@H]1[C@@H](Br)C(=O)C#N |
| InChI | InChI=1S/C11H14BrNO5/c1-11(2)17-9-8(15-3)7(16-10(9)18-11)6(12)5(14)4-13/h6-10H,1-3H3/t6-,7+,8-,9+,10-/m0/s1 |
| InChIKey | UZKWECPLRMUIDE-LRPJSKTQSA-N |
| XLogP | 0.73 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|