C13H19BrO7 — CID 11257124
2-bromo-2-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetic acid (PubChem CID 11257124) has the molecular formula C13H19BrO7 and a molecular weight of 367.19 g/mol. Its IUPAC name is 2-bromo-2-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetic acid.
| Compound Name | 2-bromo-2-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetic acid |
|---|---|
| PubChem CID | 11257124 |
| Molecular Formula | C13H19BrO7 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-bromo-2-[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetic acid |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](C(Br)C(=O)O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H19BrO7/c1-12(2)18-7-6(5(14)10(15)16)17-11-9(8(7)19-12)20-13(3,4)21-11/h5-9,11H,1-4H3,(H,15,16)/t5?,6-,7+,8+,9-,11-/m1/s1 |
| InChIKey | IICUVFAZGSJQOA-BRYMXRFFSA-N |
| XLogP | 1.23 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|