C16H27NO7 — CID 101234664
propan-2-yl (2S)-2-amino-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate (PubChem CID 101234664) has the molecular formula C16H27NO7 and a molecular weight of 345.39 g/mol. Its IUPAC name is propan-2-yl (2S)-2-amino-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate.
| Compound Name | propan-2-yl (2S)-2-amino-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
|---|---|
| PubChem CID | 101234664 |
| Molecular Formula | C16H27NO7 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | propan-2-yl (2S)-2-amino-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
| SMILES | CC(C)OC(=O)[C@@H](N)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H27NO7/c1-7(2)19-13(18)8(17)9-10-11(22-15(3,4)21-10)12-14(20-9)24-16(5,6)23-12/h7-12,14H,17H2,1-6H3/t8-,9+,10-,11-,12+,14+/m0/s1 |
| InChIKey | HLPQDORAXZUAKF-CUDMWDDJSA-N |
| XLogP | 0.66 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |