C17H25ClO8 — CID 11269386
propan-2-yl 2-chloro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxirane-2-carboxylate (PubChem CID 11269386) has the molecular formula C17H25ClO8 and a molecular weight of 392.83 g/mol. Its IUPAC name is propan-2-yl 2-chloro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxirane-2-carboxylate.
| Compound Name | propan-2-yl 2-chloro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 11269386 |
| Molecular Formula | C17H25ClO8 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | propan-2-yl 2-chloro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxirane-2-carboxylate |
| SMILES | CC(C)OC(=O)C1(Cl)OC1[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H25ClO8/c1-7(2)20-14(19)17(18)12(25-17)10-8-9(23-15(3,4)22-8)11-13(21-10)26-16(5,6)24-11/h7-13H,1-6H3/t8-,9+,10-,11-,12?,13-,17?/m1/s1 |
| InChIKey | LZSUWKHQPWRNLY-CYSKGBISSA-N |
| XLogP | 1.67 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|