C17H28NO7 — CID 101115473
CID 101115473 (PubChem CID 101115473) has the molecular formula C17H28NO7 and a molecular weight of 358.41 g/mol.
| Compound Name | CID 101115473 |
|---|---|
| PubChem CID | 101115473 |
| Molecular Formula | C17H28NO7 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)[C@@H]([NH])C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H28NO7/c1-8(2)20-14(19)9(18)7-10-11-12(23-16(3,4)22-11)13-15(21-10)25-17(5,6)24-13/h8-13,15,18H,7H2,1-6H3/t9-,10+,11-,12-,13+,15+/m0/s1 |
| InChIKey | VQHHBNLLLWHJCR-WBWNACRCSA-N |
| XLogP | 1.38 |
| TPSA | 96.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |