C14H24O7 — CID 101172438
propan-2-yl (2R)-3-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxypropanoate (PubChem CID 101172438) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is propan-2-yl (2R)-3-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxypropanoate.
| Compound Name | propan-2-yl (2R)-3-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 101172438 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | propan-2-yl (2R)-3-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxypropanoate |
| SMILES | CO[C@H]1O[C@H](C[C@@H](O)C(=O)OC(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H24O7/c1-7(2)18-12(16)8(15)6-9-10-11(13(17-5)19-9)21-14(3,4)20-10/h7-11,13,15H,6H2,1-5H3/t8-,9-,10+,11+,13+/m1/s1 |
| InChIKey | RGIVVKWPJCPBGP-IIEKFROSSA-N |
| XLogP | 0.58 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |