C13H21BrO6 — CID 101234644
propan-2-yl (2R)-2-[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-bromoacetate (PubChem CID 101234644) has the molecular formula C13H21BrO6 and a molecular weight of 353.21 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-bromoacetate.
| Compound Name | propan-2-yl (2R)-2-[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-bromoacetate |
|---|---|
| PubChem CID | 101234644 |
| Molecular Formula | C13H21BrO6 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | propan-2-yl (2R)-2-[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-bromoacetate |
| SMILES | CO[C@@H]1O[C@H]([C@@H](Br)C(=O)OC(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H21BrO6/c1-6(2)17-11(15)7(14)8-9-10(12(16-5)18-8)20-13(3,4)19-9/h6-10,12H,1-5H3/t7-,8-,9-,10-,12-/m1/s1 |
| InChIKey | IVRQQBVZYXJEQB-SANCVJEGSA-N |
| XLogP | 1.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|