C17H26BrNO8 — CID 102258932
methyl (2R)-2-[[(2R)-2-bromo-2-[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetyl]amino]propanoate (PubChem CID 102258932) has the molecular formula C17H26BrNO8 and a molecular weight of 452.30 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-2-bromo-2-[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2R)-2-bromo-2-[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 102258932 |
| Molecular Formula | C17H26BrNO8 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | methyl (2R)-2-[[(2R)-2-bromo-2-[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)[C@H](Br)[C@H]1O[C@@H]2OC(C)(C)O[C@H]2[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H26BrNO8/c1-7(14(21)22-6)19-13(20)8(18)9-10-11(25-16(2,3)24-10)12-15(23-9)27-17(4,5)26-12/h7-12,15H,1-6H3,(H,19,20)/t7-,8-,9-,10-,11+,12+,15-/m1/s1 |
| InChIKey | NXPDQOHGRJVGGU-YDKIFMJFSA-N |
| XLogP | 0.82 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|